C27H35ClN4O3 — CID 54841197
2-chloro-N-cyclohexyl-5-[[2-[3-(hexanoylamino)anilino]acetyl]amino]benzamide (PubChem CID 54841197) has the molecular formula C27H35ClN4O3 and a molecular weight of 499.06 g/mol. Its IUPAC name is 2-chloro-N-cyclohexyl-5-[[2-[3-(hexanoylamino)anilino]acetyl]amino]benzamide.
| Compound Name | 2-chloro-N-cyclohexyl-5-[[2-[3-(hexanoylamino)anilino]acetyl]amino]benzamide |
|---|---|
| PubChem CID | 54841197 |
| Molecular Formula | C27H35ClN4O3 |
| Molecular Weight | 499.06 g/mol |
| Exact Mass | 498.24 |
| IUPAC Name | 2-chloro-N-cyclohexyl-5-[[2-[3-(hexanoylamino)anilino]acetyl]amino]benzamide |
| SMILES | CCCCCC(=O)Nc1cccc(NCC(=O)Nc2ccc(Cl)c(C(=O)NC3CCCCC3)c2)c1 |
| InChI | InChI=1S/C27H35ClN4O3/c1-2-3-5-13-25(33)30-21-12-8-11-20(16-21)29-18-26(34)31-22-14-15-24(28)23(17-22)27(35)32-19-9-6-4-7-10-19/h8,11-12,14-17,19,29H,2-7,9-10,13,18H2,1H3,(H,30,33)(H,31,34)(H,32,35) |
| InChIKey | ZNALDEHOUIYZGH-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 99.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.06 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|