C30H33ClN4O3 — CID 54833006
2-chloro-N-cyclohexyl-5-[[2-oxo-2-[4-(3-phenylpropanoylamino)anilino]ethyl]amino]benzamide (PubChem CID 54833006) has the molecular formula C30H33ClN4O3 and a molecular weight of 533.07 g/mol. Its IUPAC name is 2-chloro-N-cyclohexyl-5-[[2-oxo-2-[4-(3-phenylpropanoylamino)anilino]ethyl]amino]benzamide.
| Compound Name | 2-chloro-N-cyclohexyl-5-[[2-oxo-2-[4-(3-phenylpropanoylamino)anilino]ethyl]amino]benzamide |
|---|---|
| PubChem CID | 54833006 |
| Molecular Formula | C30H33ClN4O3 |
| Molecular Weight | 533.07 g/mol |
| Exact Mass | 532.22 |
| IUPAC Name | 2-chloro-N-cyclohexyl-5-[[2-oxo-2-[4-(3-phenylpropanoylamino)anilino]ethyl]amino]benzamide |
| SMILES | O=C(CCc1ccccc1)Nc1ccc(NC(=O)CNc2ccc(Cl)c(C(=O)NC3CCCCC3)c2)cc1 |
| InChI | InChI=1S/C30H33ClN4O3/c31-27-17-16-25(19-26(27)30(38)35-22-9-5-2-6-10-22)32-20-29(37)34-24-14-12-23(13-15-24)33-28(36)18-11-21-7-3-1-4-8-21/h1,3-4,7-8,12-17,19,22,32H,2,5-6,9-11,18,20H2,(H,33,36)(H,34,37)(H,35,38) |
| InChIKey | RZZZBCOFOBHRLU-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 99.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.07 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |