C22H26ClN3O3 — CID 54833298
2-chloro-N-cyclohexyl-5-[[2-(4-methoxyanilino)-2-oxoethyl]amino]benzamide (PubChem CID 54833298) has the molecular formula C22H26ClN3O3 and a molecular weight of 415.92 g/mol. Its IUPAC name is 2-chloro-N-cyclohexyl-5-[[2-(4-methoxyanilino)-2-oxoethyl]amino]benzamide.
| Compound Name | 2-chloro-N-cyclohexyl-5-[[2-(4-methoxyanilino)-2-oxoethyl]amino]benzamide |
|---|---|
| PubChem CID | 54833298 |
| Molecular Formula | C22H26ClN3O3 |
| Molecular Weight | 415.92 g/mol |
| Exact Mass | 415.17 |
| IUPAC Name | 2-chloro-N-cyclohexyl-5-[[2-(4-methoxyanilino)-2-oxoethyl]amino]benzamide |
| SMILES | COc1ccc(NC(=O)CNc2ccc(Cl)c(C(=O)NC3CCCCC3)c2)cc1 |
| InChI | InChI=1S/C22H26ClN3O3/c1-29-18-10-7-16(8-11-18)25-21(27)14-24-17-9-12-20(23)19(13-17)22(28)26-15-5-3-2-4-6-15/h7-13,15,24H,2-6,14H2,1H3,(H,25,27)(H,26,28) |
| InChIKey | SYAXQGUHTADTTR-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.92 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |