C25H32ClN3O4 — CID 54833128
2-chloro-N-cyclohexyl-5-[[2-[4-(2-ethoxyethoxy)anilino]-2-oxoethyl]amino]benzamide (PubChem CID 54833128) has the molecular formula C25H32ClN3O4 and a molecular weight of 474.00 g/mol. Its IUPAC name is 2-chloro-N-cyclohexyl-5-[[2-[4-(2-ethoxyethoxy)anilino]-2-oxoethyl]amino]benzamide.
| Compound Name | 2-chloro-N-cyclohexyl-5-[[2-[4-(2-ethoxyethoxy)anilino]-2-oxoethyl]amino]benzamide |
|---|---|
| PubChem CID | 54833128 |
| Molecular Formula | C25H32ClN3O4 |
| Molecular Weight | 474.00 g/mol |
| Exact Mass | 473.21 |
| IUPAC Name | 2-chloro-N-cyclohexyl-5-[[2-[4-(2-ethoxyethoxy)anilino]-2-oxoethyl]amino]benzamide |
| SMILES | CCOCCOc1ccc(NC(=O)CNc2ccc(Cl)c(C(=O)NC3CCCCC3)c2)cc1 |
| InChI | InChI=1S/C25H32ClN3O4/c1-2-32-14-15-33-21-11-8-19(9-12-21)28-24(30)17-27-20-10-13-23(26)22(16-20)25(31)29-18-6-4-3-5-7-18/h8-13,16,18,27H,2-7,14-15,17H2,1H3,(H,28,30)(H,29,31) |
| InChIKey | XBOOANNPWOOFOO-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.00 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|