C25H30ClN3O4S — CID 17188787
2-chloro-N-cyclohexyl-5-[[4-(2-ethoxyethoxy)benzoyl]carbamothioylamino]benzamide (PubChem CID 17188787) has the molecular formula C25H30ClN3O4S and a molecular weight of 504.05 g/mol. Its IUPAC name is 2-chloro-N-cyclohexyl-5-[[4-(2-ethoxyethoxy)benzoyl]carbamothioylamino]benzamide.
| Compound Name | 2-chloro-N-cyclohexyl-5-[[4-(2-ethoxyethoxy)benzoyl]carbamothioylamino]benzamide |
|---|---|
| PubChem CID | 17188787 |
| Molecular Formula | C25H30ClN3O4S |
| Molecular Weight | 504.05 g/mol |
| Exact Mass | 503.16 |
| IUPAC Name | 2-chloro-N-cyclohexyl-5-[[4-(2-ethoxyethoxy)benzoyl]carbamothioylamino]benzamide |
| SMILES | CCOCCOc1ccc(C(=O)NC(=S)Nc2ccc(Cl)c(C(=O)NC3CCCCC3)c2)cc1 |
| InChI | InChI=1S/C25H30ClN3O4S/c1-2-32-14-15-33-20-11-8-17(9-12-20)23(30)29-25(34)28-19-10-13-22(26)21(16-19)24(31)27-18-6-4-3-5-7-18/h8-13,16,18H,2-7,14-15H2,1H3,(H,27,31)(H2,28,29,30,34) |
| InChIKey | MMFOHDOBBPUBRL-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.05 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|