C24H28ClN3O2S — CID 17188800
2-chloro-N-cyclohexyl-5-[(4-propan-2-ylbenzoyl)carbamothioylamino]benzamide (PubChem CID 17188800) has the molecular formula C24H28ClN3O2S and a molecular weight of 458.03 g/mol. Its IUPAC name is 2-chloro-N-cyclohexyl-5-[(4-propan-2-ylbenzoyl)carbamothioylamino]benzamide.
| Compound Name | 2-chloro-N-cyclohexyl-5-[(4-propan-2-ylbenzoyl)carbamothioylamino]benzamide |
|---|---|
| PubChem CID | 17188800 |
| Molecular Formula | C24H28ClN3O2S |
| Molecular Weight | 458.03 g/mol |
| Exact Mass | 457.16 |
| IUPAC Name | 2-chloro-N-cyclohexyl-5-[(4-propan-2-ylbenzoyl)carbamothioylamino]benzamide |
| SMILES | CC(C)c1ccc(C(=O)NC(=S)Nc2ccc(Cl)c(C(=O)NC3CCCCC3)c2)cc1 |
| InChI | InChI=1S/C24H28ClN3O2S/c1-15(2)16-8-10-17(11-9-16)22(29)28-24(31)27-19-12-13-21(25)20(14-19)23(30)26-18-6-4-3-5-7-18/h8-15,18H,3-7H2,1-2H3,(H,26,30)(H2,27,28,29,31) |
| InChIKey | QTOGHIQYEJHFFM-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.03 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|