C23H26ClN3O2S — CID 17188686
2-chloro-N-cyclohexyl-5-(3-phenylpropanoylcarbamothioylamino)benzamide (PubChem CID 17188686) has the molecular formula C23H26ClN3O2S and a molecular weight of 444.00 g/mol. Its IUPAC name is 2-chloro-N-cyclohexyl-5-(3-phenylpropanoylcarbamothioylamino)benzamide.
| Compound Name | 2-chloro-N-cyclohexyl-5-(3-phenylpropanoylcarbamothioylamino)benzamide |
|---|---|
| PubChem CID | 17188686 |
| Molecular Formula | C23H26ClN3O2S |
| Molecular Weight | 444.00 g/mol |
| Exact Mass | 443.14 |
| IUPAC Name | 2-chloro-N-cyclohexyl-5-(3-phenylpropanoylcarbamothioylamino)benzamide |
| SMILES | O=C(CCc1ccccc1)NC(=S)Nc1ccc(Cl)c(C(=O)NC2CCCCC2)c1 |
| InChI | InChI=1S/C23H26ClN3O2S/c24-20-13-12-18(15-19(20)22(29)25-17-9-5-2-6-10-17)26-23(30)27-21(28)14-11-16-7-3-1-4-8-16/h1,3-4,7-8,12-13,15,17H,2,5-6,9-11,14H2,(H,25,29)(H2,26,27,28,30) |
| InChIKey | CXJOVNJUYDBVCH-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.00 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|