C28H29ClN2O3 — CID 17188525
2-chloro-N-cyclohexyl-5-[[4-(2-phenylethoxy)benzoyl]amino]benzamide (PubChem CID 17188525) has the molecular formula C28H29ClN2O3 and a molecular weight of 477.00 g/mol. Its IUPAC name is 2-chloro-N-cyclohexyl-5-[[4-(2-phenylethoxy)benzoyl]amino]benzamide.
| Compound Name | 2-chloro-N-cyclohexyl-5-[[4-(2-phenylethoxy)benzoyl]amino]benzamide |
|---|---|
| PubChem CID | 17188525 |
| Molecular Formula | C28H29ClN2O3 |
| Molecular Weight | 477.00 g/mol |
| Exact Mass | 476.19 |
| IUPAC Name | 2-chloro-N-cyclohexyl-5-[[4-(2-phenylethoxy)benzoyl]amino]benzamide |
| SMILES | O=C(Nc1ccc(Cl)c(C(=O)NC2CCCCC2)c1)c1ccc(OCCc2ccccc2)cc1 |
| InChI | InChI=1S/C28H29ClN2O3/c29-26-16-13-23(19-25(26)28(33)30-22-9-5-2-6-10-22)31-27(32)21-11-14-24(15-12-21)34-18-17-20-7-3-1-4-8-20/h1,3-4,7-8,11-16,19,22H,2,5-6,9-10,17-18H2,(H,30,33)(H,31,32) |
| InChIKey | MBMHDKJUXLAESL-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.00 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |