C20H22ClN3O2 — CID 17188425
2-chloro-N-cyclohexyl-5-(phenylcarbamoylamino)benzamide (PubChem CID 17188425) has the molecular formula C20H22ClN3O2 and a molecular weight of 371.87 g/mol. Its IUPAC name is 2-chloro-N-cyclohexyl-5-(phenylcarbamoylamino)benzamide.
| Compound Name | 2-chloro-N-cyclohexyl-5-(phenylcarbamoylamino)benzamide |
|---|---|
| PubChem CID | 17188425 |
| Molecular Formula | C20H22ClN3O2 |
| Molecular Weight | 371.87 g/mol |
| Exact Mass | 371.14 |
| IUPAC Name | 2-chloro-N-cyclohexyl-5-(phenylcarbamoylamino)benzamide |
| SMILES | O=C(Nc1ccccc1)Nc1ccc(Cl)c(C(=O)NC2CCCCC2)c1 |
| InChI | InChI=1S/C20H22ClN3O2/c21-18-12-11-16(24-20(26)23-15-9-5-2-6-10-15)13-17(18)19(25)22-14-7-3-1-4-8-14/h2,5-6,9-14H,1,3-4,7-8H2,(H,22,25)(H2,23,24,26) |
| InChIKey | JXAMRWPFVVGLKQ-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.87 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |