C19H26ClN3O2 — CID 119300196
N-[4-chloro-3-(cyclohexylcarbamoyl)phenyl]piperidine-3-carboxamide (PubChem CID 119300196) has the molecular formula C19H26ClN3O2 and a molecular weight of 363.89 g/mol. Its IUPAC name is N-[4-chloro-3-(cyclohexylcarbamoyl)phenyl]piperidine-3-carboxamide.
| Compound Name | N-[4-chloro-3-(cyclohexylcarbamoyl)phenyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 119300196 |
| Molecular Formula | C19H26ClN3O2 |
| Molecular Weight | 363.89 g/mol |
| Exact Mass | 363.17 |
| IUPAC Name | N-[4-chloro-3-(cyclohexylcarbamoyl)phenyl]piperidine-3-carboxamide |
| SMILES | O=C(NC1CCCCC1)c1cc(NC(=O)C2CCCNC2)ccc1Cl |
| InChI | InChI=1S/C19H26ClN3O2/c20-17-9-8-15(23-18(24)13-5-4-10-21-12-13)11-16(17)19(25)22-14-6-2-1-3-7-14/h8-9,11,13-14,21H,1-7,10,12H2,(H,22,25)(H,23,24) |
| InChIKey | ZZAMWUPVZYJPQN-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.89 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |