C28H29ClN2O4 — CID 17188518
2-chloro-N-cyclohexyl-5-[[4-(2-phenoxyethoxy)benzoyl]amino]benzamide (PubChem CID 17188518) has the molecular formula C28H29ClN2O4 and a molecular weight of 493.00 g/mol. Its IUPAC name is 2-chloro-N-cyclohexyl-5-[[4-(2-phenoxyethoxy)benzoyl]amino]benzamide.
| Compound Name | 2-chloro-N-cyclohexyl-5-[[4-(2-phenoxyethoxy)benzoyl]amino]benzamide |
|---|---|
| PubChem CID | 17188518 |
| Molecular Formula | C28H29ClN2O4 |
| Molecular Weight | 493.00 g/mol |
| Exact Mass | 492.18 |
| IUPAC Name | 2-chloro-N-cyclohexyl-5-[[4-(2-phenoxyethoxy)benzoyl]amino]benzamide |
| SMILES | O=C(Nc1ccc(Cl)c(C(=O)NC2CCCCC2)c1)c1ccc(OCCOc2ccccc2)cc1 |
| InChI | InChI=1S/C28H29ClN2O4/c29-26-16-13-22(19-25(26)28(33)30-21-7-3-1-4-8-21)31-27(32)20-11-14-24(15-12-20)35-18-17-34-23-9-5-2-6-10-23/h2,5-6,9-16,19,21H,1,3-4,7-8,17-18H2,(H,30,33)(H,31,32) |
| InChIKey | RAWUZPUCJOWJKD-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.00 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|