C24H27ClN2O2 — CID 52707482
2-chloro-N-cyclohexyl-5-[(1-phenylcyclobutanecarbonyl)amino]benzamide (PubChem CID 52707482) has the molecular formula C24H27ClN2O2 and a molecular weight of 410.95 g/mol. Its IUPAC name is 2-chloro-N-cyclohexyl-5-[(1-phenylcyclobutanecarbonyl)amino]benzamide.
| Compound Name | 2-chloro-N-cyclohexyl-5-[(1-phenylcyclobutanecarbonyl)amino]benzamide |
|---|---|
| PubChem CID | 52707482 |
| Molecular Formula | C24H27ClN2O2 |
| Molecular Weight | 410.95 g/mol |
| Exact Mass | 410.18 |
| IUPAC Name | 2-chloro-N-cyclohexyl-5-[(1-phenylcyclobutanecarbonyl)amino]benzamide |
| SMILES | O=C(NC1CCCCC1)c1cc(NC(=O)C2(c3ccccc3)CCC2)ccc1Cl |
| InChI | InChI=1S/C24H27ClN2O2/c25-21-13-12-19(16-20(21)22(28)26-18-10-5-2-6-11-18)27-23(29)24(14-7-15-24)17-8-3-1-4-9-17/h1,3-4,8-9,12-13,16,18H,2,5-7,10-11,14-15H2,(H,26,28)(H,27,29) |
| InChIKey | FVAZCZUMSBMFHV-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.95 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |