C18H26ClN3O2 — CID 119743114
2-chloro-N-cyclohexyl-5-[4-(methylamino)butanoylamino]benzamide (PubChem CID 119743114) has the molecular formula C18H26ClN3O2 and a molecular weight of 351.88 g/mol. Its IUPAC name is 2-chloro-N-cyclohexyl-5-[4-(methylamino)butanoylamino]benzamide.
| Compound Name | 2-chloro-N-cyclohexyl-5-[4-(methylamino)butanoylamino]benzamide |
|---|---|
| PubChem CID | 119743114 |
| Molecular Formula | C18H26ClN3O2 |
| Molecular Weight | 351.88 g/mol |
| Exact Mass | 351.17 |
| IUPAC Name | 2-chloro-N-cyclohexyl-5-[4-(methylamino)butanoylamino]benzamide |
| SMILES | CNCCCC(=O)Nc1ccc(Cl)c(C(=O)NC2CCCCC2)c1 |
| InChI | InChI=1S/C18H26ClN3O2/c1-20-11-5-8-17(23)21-14-9-10-16(19)15(12-14)18(24)22-13-6-3-2-4-7-13/h9-10,12-13,20H,2-8,11H2,1H3,(H,21,23)(H,22,24) |
| InChIKey | WSZVZUQDLRSPKP-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.88 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|