C21H30ClN3O2S — CID 54789372
2-chloro-N-cyclohexyl-5-(heptanoylcarbamothioylamino)benzamide (PubChem CID 54789372) has the molecular formula C21H30ClN3O2S and a molecular weight of 424.01 g/mol. Its IUPAC name is 2-chloro-N-cyclohexyl-5-(heptanoylcarbamothioylamino)benzamide.
| Compound Name | 2-chloro-N-cyclohexyl-5-(heptanoylcarbamothioylamino)benzamide |
|---|---|
| PubChem CID | 54789372 |
| Molecular Formula | C21H30ClN3O2S |
| Molecular Weight | 424.01 g/mol |
| Exact Mass | 423.17 |
| IUPAC Name | 2-chloro-N-cyclohexyl-5-(heptanoylcarbamothioylamino)benzamide |
| SMILES | CCCCCCC(=O)NC(=S)Nc1ccc(Cl)c(C(=O)NC2CCCCC2)c1 |
| InChI | InChI=1S/C21H30ClN3O2S/c1-2-3-4-8-11-19(26)25-21(28)24-16-12-13-18(22)17(14-16)20(27)23-15-9-6-5-7-10-15/h12-15H,2-11H2,1H3,(H,23,27)(H2,24,25,26,28) |
| InChIKey | QGZOFXQBCGUOIM-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.01 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|