C28H37N3O3S — CID 43878562
N-cyclohexyl-4-[(4-heptoxybenzoyl)carbamothioylamino]benzamide (PubChem CID 43878562) has the molecular formula C28H37N3O3S and a molecular weight of 495.69 g/mol. Its IUPAC name is N-cyclohexyl-4-[(4-heptoxybenzoyl)carbamothioylamino]benzamide.
| Compound Name | N-cyclohexyl-4-[(4-heptoxybenzoyl)carbamothioylamino]benzamide |
|---|---|
| PubChem CID | 43878562 |
| Molecular Formula | C28H37N3O3S |
| Molecular Weight | 495.69 g/mol |
| Exact Mass | 495.26 |
| IUPAC Name | N-cyclohexyl-4-[(4-heptoxybenzoyl)carbamothioylamino]benzamide |
| SMILES | CCCCCCCOc1ccc(C(=O)NC(=S)Nc2ccc(C(=O)NC3CCCCC3)cc2)cc1 |
| InChI | InChI=1S/C28H37N3O3S/c1-2-3-4-5-9-20-34-25-18-14-22(15-19-25)27(33)31-28(35)30-24-16-12-21(13-17-24)26(32)29-23-10-7-6-8-11-23/h12-19,23H,2-11,20H2,1H3,(H,29,32)(H2,30,31,33,35) |
| InChIKey | XOPYYJGJWXNYJT-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.69 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|