C26H33N3O3S — CID 28587927
N-[[4-(cyclohexylcarbamoyl)phenyl]carbamothioyl]-2-pentoxybenzamide (PubChem CID 28587927) has the molecular formula C26H33N3O3S and a molecular weight of 467.64 g/mol. Its IUPAC name is N-[[4-(cyclohexylcarbamoyl)phenyl]carbamothioyl]-2-pentoxybenzamide.
| Compound Name | N-[[4-(cyclohexylcarbamoyl)phenyl]carbamothioyl]-2-pentoxybenzamide |
|---|---|
| PubChem CID | 28587927 |
| Molecular Formula | C26H33N3O3S |
| Molecular Weight | 467.64 g/mol |
| Exact Mass | 467.22 |
| IUPAC Name | N-[[4-(cyclohexylcarbamoyl)phenyl]carbamothioyl]-2-pentoxybenzamide |
| SMILES | CCCCCOc1ccccc1C(=O)NC(=S)Nc1ccc(C(=O)NC2CCCCC2)cc1 |
| InChI | InChI=1S/C26H33N3O3S/c1-2-3-9-18-32-23-13-8-7-12-22(23)25(31)29-26(33)28-21-16-14-19(15-17-21)24(30)27-20-10-5-4-6-11-20/h7-8,12-17,20H,2-6,9-11,18H2,1H3,(H,27,30)(H2,28,29,31,33) |
| InChIKey | WAGUZRCSNHUCGM-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.64 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|