C21H24N2O3S — CID 4946997
N-[(4-acetylphenyl)carbamothioyl]-2-pentoxybenzamide (PubChem CID 4946997) has the molecular formula C21H24N2O3S and a molecular weight of 384.50 g/mol. Its IUPAC name is N-[(4-acetylphenyl)carbamothioyl]-2-pentoxybenzamide.
| Compound Name | N-[(4-acetylphenyl)carbamothioyl]-2-pentoxybenzamide |
|---|---|
| PubChem CID | 4946997 |
| Molecular Formula | C21H24N2O3S |
| Molecular Weight | 384.50 g/mol |
| Exact Mass | 384.15 |
| IUPAC Name | N-[(4-acetylphenyl)carbamothioyl]-2-pentoxybenzamide |
| SMILES | CCCCCOc1ccccc1C(=O)NC(=S)Nc1ccc(C(C)=O)cc1 |
| InChI | InChI=1S/C21H24N2O3S/c1-3-4-7-14-26-19-9-6-5-8-18(19)20(25)23-21(27)22-17-12-10-16(11-13-17)15(2)24/h5-6,8-13H,3-4,7,14H2,1-2H3,(H2,22,23,25,27) |
| InChIKey | BQBPAASBISTWSC-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.50 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|