C22H26N2O3S — CID 4942527
N-[(3-acetylphenyl)carbamothioyl]-2-hexoxybenzamide (PubChem CID 4942527) has the molecular formula C22H26N2O3S and a molecular weight of 398.53 g/mol. Its IUPAC name is N-[(3-acetylphenyl)carbamothioyl]-2-hexoxybenzamide.
| Compound Name | N-[(3-acetylphenyl)carbamothioyl]-2-hexoxybenzamide |
|---|---|
| PubChem CID | 4942527 |
| Molecular Formula | C22H26N2O3S |
| Molecular Weight | 398.53 g/mol |
| Exact Mass | 398.17 |
| IUPAC Name | N-[(3-acetylphenyl)carbamothioyl]-2-hexoxybenzamide |
| SMILES | CCCCCCOc1ccccc1C(=O)NC(=S)Nc1cccc(C(C)=O)c1 |
| InChI | InChI=1S/C22H26N2O3S/c1-3-4-5-8-14-27-20-13-7-6-12-19(20)21(26)24-22(28)23-18-11-9-10-17(15-18)16(2)25/h6-7,9-13,15H,3-5,8,14H2,1-2H3,(H2,23,24,26,28) |
| InChIKey | RMSRDFDROIXRNE-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.53 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|