C25H24FN3O3S — CID 26159800
2-butoxy-N-[[3-[(4-fluorophenyl)carbamoyl]phenyl]carbamothioyl]benzamide (PubChem CID 26159800) has the molecular formula C25H24FN3O3S and a molecular weight of 465.55 g/mol. Its IUPAC name is 2-butoxy-N-[[3-[(4-fluorophenyl)carbamoyl]phenyl]carbamothioyl]benzamide.
| Compound Name | 2-butoxy-N-[[3-[(4-fluorophenyl)carbamoyl]phenyl]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 26159800 |
| Molecular Formula | C25H24FN3O3S |
| Molecular Weight | 465.55 g/mol |
| Exact Mass | 465.15 |
| IUPAC Name | 2-butoxy-N-[[3-[(4-fluorophenyl)carbamoyl]phenyl]carbamothioyl]benzamide |
| SMILES | CCCCOc1ccccc1C(=O)NC(=S)Nc1cccc(C(=O)Nc2ccc(F)cc2)c1 |
| InChI | InChI=1S/C25H24FN3O3S/c1-2-3-15-32-22-10-5-4-9-21(22)24(31)29-25(33)28-20-8-6-7-17(16-20)23(30)27-19-13-11-18(26)12-14-19/h4-14,16H,2-3,15H2,1H3,(H,27,30)(H2,28,29,31,33) |
| InChIKey | XOJHFWFHNDPZIU-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.55 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|