C26H24F3N3O3S — CID 26168264
2-butoxy-N-[[3-[[3-(trifluoromethyl)phenyl]carbamoyl]phenyl]carbamothioyl]benzamide (PubChem CID 26168264) has the molecular formula C26H24F3N3O3S and a molecular weight of 515.56 g/mol. Its IUPAC name is 2-butoxy-N-[[3-[[3-(trifluoromethyl)phenyl]carbamoyl]phenyl]carbamothioyl]benzamide.
| Compound Name | 2-butoxy-N-[[3-[[3-(trifluoromethyl)phenyl]carbamoyl]phenyl]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 26168264 |
| Molecular Formula | C26H24F3N3O3S |
| Molecular Weight | 515.56 g/mol |
| Exact Mass | 515.15 |
| IUPAC Name | 2-butoxy-N-[[3-[[3-(trifluoromethyl)phenyl]carbamoyl]phenyl]carbamothioyl]benzamide |
| SMILES | CCCCOc1ccccc1C(=O)NC(=S)Nc1cccc(C(=O)Nc2cccc(C(F)(F)F)c2)c1 |
| InChI | InChI=1S/C26H24F3N3O3S/c1-2-3-14-35-22-13-5-4-12-21(22)24(34)32-25(36)31-19-10-6-8-17(15-19)23(33)30-20-11-7-9-18(16-20)26(27,28)29/h4-13,15-16H,2-3,14H2,1H3,(H,30,33)(H2,31,32,34,36) |
| InChIKey | TXJGOQJPNCYDEG-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.56 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|