C23H28N2O3S — CID 17086853
2-hexoxy-N-[(3-prop-2-enoxyphenyl)carbamothioyl]benzamide (PubChem CID 17086853) has the molecular formula C23H28N2O3S and a molecular weight of 412.56 g/mol. Its IUPAC name is 2-hexoxy-N-[(3-prop-2-enoxyphenyl)carbamothioyl]benzamide.
| Compound Name | 2-hexoxy-N-[(3-prop-2-enoxyphenyl)carbamothioyl]benzamide |
|---|---|
| PubChem CID | 17086853 |
| Molecular Formula | C23H28N2O3S |
| Molecular Weight | 412.56 g/mol |
| Exact Mass | 412.18 |
| IUPAC Name | 2-hexoxy-N-[(3-prop-2-enoxyphenyl)carbamothioyl]benzamide |
| SMILES | C=CCOc1cccc(NC(=S)NC(=O)c2ccccc2OCCCCCC)c1 |
| InChI | InChI=1S/C23H28N2O3S/c1-3-5-6-9-16-28-21-14-8-7-13-20(21)22(26)25-23(29)24-18-11-10-12-19(17-18)27-15-4-2/h4,7-8,10-14,17H,2-3,5-6,9,15-16H2,1H3,(H2,24,25,26,29) |
| InChIKey | QGNLACVABGFTQY-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.56 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|