C24H29ClN4O3 — CID 54833099
2-chloro-N-cyclohexyl-5-[[2-oxo-2-[3-(propanoylamino)anilino]ethyl]amino]benzamide (PubChem CID 54833099) has the molecular formula C24H29ClN4O3 and a molecular weight of 456.97 g/mol. Its IUPAC name is 2-chloro-N-cyclohexyl-5-[[2-oxo-2-[3-(propanoylamino)anilino]ethyl]amino]benzamide.
| Compound Name | 2-chloro-N-cyclohexyl-5-[[2-oxo-2-[3-(propanoylamino)anilino]ethyl]amino]benzamide |
|---|---|
| PubChem CID | 54833099 |
| Molecular Formula | C24H29ClN4O3 |
| Molecular Weight | 456.97 g/mol |
| Exact Mass | 456.19 |
| IUPAC Name | 2-chloro-N-cyclohexyl-5-[[2-oxo-2-[3-(propanoylamino)anilino]ethyl]amino]benzamide |
| SMILES | CCC(=O)Nc1cccc(NC(=O)CNc2ccc(Cl)c(C(=O)NC3CCCCC3)c2)c1 |
| InChI | InChI=1S/C24H29ClN4O3/c1-2-22(30)27-18-9-6-10-19(13-18)28-23(31)15-26-17-11-12-21(25)20(14-17)24(32)29-16-7-4-3-5-8-16/h6,9-14,16,26H,2-5,7-8,15H2,1H3,(H,27,30)(H,28,31)(H,29,32) |
| InChIKey | UQBJOSDSLZGSRH-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 99.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.97 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |