C28H35ClN4O3 — CID 54833251
5-[[2-[3-(azepane-1-carbonyl)anilino]-2-oxoethyl]amino]-2-chloro-N-cyclohexylbenzamide (PubChem CID 54833251) has the molecular formula C28H35ClN4O3 and a molecular weight of 511.07 g/mol. Its IUPAC name is 5-[[2-[3-(azepane-1-carbonyl)anilino]-2-oxoethyl]amino]-2-chloro-N-cyclohexylbenzamide.
| Compound Name | 5-[[2-[3-(azepane-1-carbonyl)anilino]-2-oxoethyl]amino]-2-chloro-N-cyclohexylbenzamide |
|---|---|
| PubChem CID | 54833251 |
| Molecular Formula | C28H35ClN4O3 |
| Molecular Weight | 511.07 g/mol |
| Exact Mass | 510.24 |
| IUPAC Name | 5-[[2-[3-(azepane-1-carbonyl)anilino]-2-oxoethyl]amino]-2-chloro-N-cyclohexylbenzamide |
| SMILES | O=C(CNc1ccc(Cl)c(C(=O)NC2CCCCC2)c1)Nc1cccc(C(=O)N2CCCCCC2)c1 |
| InChI | InChI=1S/C28H35ClN4O3/c29-25-14-13-22(18-24(25)27(35)32-21-10-4-3-5-11-21)30-19-26(34)31-23-12-8-9-20(17-23)28(36)33-15-6-1-2-7-16-33/h8-9,12-14,17-18,21,30H,1-7,10-11,15-16,19H2,(H,31,34)(H,32,35) |
| InChIKey | NAUJNCXUAXZIBR-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.07 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |