C25H26ClN3O2 — CID 54832996
2-chloro-N-cyclohexyl-5-[[2-(naphthalen-1-ylamino)-2-oxoethyl]amino]benzamide (PubChem CID 54832996) has the molecular formula C25H26ClN3O2 and a molecular weight of 435.96 g/mol. Its IUPAC name is 2-chloro-N-cyclohexyl-5-[[2-(naphthalen-1-ylamino)-2-oxoethyl]amino]benzamide.
| Compound Name | 2-chloro-N-cyclohexyl-5-[[2-(naphthalen-1-ylamino)-2-oxoethyl]amino]benzamide |
|---|---|
| PubChem CID | 54832996 |
| Molecular Formula | C25H26ClN3O2 |
| Molecular Weight | 435.96 g/mol |
| Exact Mass | 435.17 |
| IUPAC Name | 2-chloro-N-cyclohexyl-5-[[2-(naphthalen-1-ylamino)-2-oxoethyl]amino]benzamide |
| SMILES | O=C(CNc1ccc(Cl)c(C(=O)NC2CCCCC2)c1)Nc1cccc2ccccc12 |
| InChI | InChI=1S/C25H26ClN3O2/c26-22-14-13-19(15-21(22)25(31)28-18-9-2-1-3-10-18)27-16-24(30)29-23-12-6-8-17-7-4-5-11-20(17)23/h4-8,11-15,18,27H,1-3,9-10,16H2,(H,28,31)(H,29,30) |
| InChIKey | VSMAXYDZVKGEAJ-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.96 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |