C24H30ClN3O3 — CID 54832913
2-chloro-N-cyclohexyl-5-[[2-oxo-2-(2-propan-2-yloxyanilino)ethyl]amino]benzamide (PubChem CID 54832913) has the molecular formula C24H30ClN3O3 and a molecular weight of 443.98 g/mol. Its IUPAC name is 2-chloro-N-cyclohexyl-5-[[2-oxo-2-(2-propan-2-yloxyanilino)ethyl]amino]benzamide.
| Compound Name | 2-chloro-N-cyclohexyl-5-[[2-oxo-2-(2-propan-2-yloxyanilino)ethyl]amino]benzamide |
|---|---|
| PubChem CID | 54832913 |
| Molecular Formula | C24H30ClN3O3 |
| Molecular Weight | 443.98 g/mol |
| Exact Mass | 443.20 |
| IUPAC Name | 2-chloro-N-cyclohexyl-5-[[2-oxo-2-(2-propan-2-yloxyanilino)ethyl]amino]benzamide |
| SMILES | CC(C)Oc1ccccc1NC(=O)CNc1ccc(Cl)c(C(=O)NC2CCCCC2)c1 |
| InChI | InChI=1S/C24H30ClN3O3/c1-16(2)31-22-11-7-6-10-21(22)28-23(29)15-26-18-12-13-20(25)19(14-18)24(30)27-17-8-4-3-5-9-17/h6-7,10-14,16-17,26H,3-5,8-9,15H2,1-2H3,(H,27,30)(H,28,29) |
| InChIKey | ZORDRAMGZIYEBE-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.98 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |