C24H28ClN3O3 — CID 54824326
2-chloro-N-cyclohexyl-5-[[2-(2-prop-2-enoxyanilino)acetyl]amino]benzamide (PubChem CID 54824326) has the molecular formula C24H28ClN3O3 and a molecular weight of 441.96 g/mol. Its IUPAC name is 2-chloro-N-cyclohexyl-5-[[2-(2-prop-2-enoxyanilino)acetyl]amino]benzamide.
| Compound Name | 2-chloro-N-cyclohexyl-5-[[2-(2-prop-2-enoxyanilino)acetyl]amino]benzamide |
|---|---|
| PubChem CID | 54824326 |
| Molecular Formula | C24H28ClN3O3 |
| Molecular Weight | 441.96 g/mol |
| Exact Mass | 441.18 |
| IUPAC Name | 2-chloro-N-cyclohexyl-5-[[2-(2-prop-2-enoxyanilino)acetyl]amino]benzamide |
| SMILES | C=CCOc1ccccc1NCC(=O)Nc1ccc(Cl)c(C(=O)NC2CCCCC2)c1 |
| InChI | InChI=1S/C24H28ClN3O3/c1-2-14-31-22-11-7-6-10-21(22)26-16-23(29)27-18-12-13-20(25)19(15-18)24(30)28-17-8-4-3-5-9-17/h2,6-7,10-13,15,17,26H,1,3-5,8-9,14,16H2,(H,27,29)(H,28,30) |
| InChIKey | UFLMNBQIAKAUEF-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.96 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|