C28H30ClN3O3 — CID 54827792
2-chloro-N-cyclohexyl-5-[[2-(2-phenylmethoxyanilino)acetyl]amino]benzamide (PubChem CID 54827792) has the molecular formula C28H30ClN3O3 and a molecular weight of 492.02 g/mol. Its IUPAC name is 2-chloro-N-cyclohexyl-5-[[2-(2-phenylmethoxyanilino)acetyl]amino]benzamide.
| Compound Name | 2-chloro-N-cyclohexyl-5-[[2-(2-phenylmethoxyanilino)acetyl]amino]benzamide |
|---|---|
| PubChem CID | 54827792 |
| Molecular Formula | C28H30ClN3O3 |
| Molecular Weight | 492.02 g/mol |
| Exact Mass | 491.20 |
| IUPAC Name | 2-chloro-N-cyclohexyl-5-[[2-(2-phenylmethoxyanilino)acetyl]amino]benzamide |
| SMILES | O=C(CNc1ccccc1OCc1ccccc1)Nc1ccc(Cl)c(C(=O)NC2CCCCC2)c1 |
| InChI | InChI=1S/C28H30ClN3O3/c29-24-16-15-22(17-23(24)28(34)32-21-11-5-2-6-12-21)31-27(33)18-30-25-13-7-8-14-26(25)35-19-20-9-3-1-4-10-20/h1,3-4,7-10,13-17,21,30H,2,5-6,11-12,18-19H2,(H,31,33)(H,32,34) |
| InChIKey | SSJMLWHIHXGEBX-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.02 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |