C21H22Cl3N3O2 — CID 54819816
2-chloro-N-cyclohexyl-5-[[2-(2,5-dichloroanilino)acetyl]amino]benzamide (PubChem CID 54819816) has the molecular formula C21H22Cl3N3O2 and a molecular weight of 454.79 g/mol. Its IUPAC name is 2-chloro-N-cyclohexyl-5-[[2-(2,5-dichloroanilino)acetyl]amino]benzamide.
| Compound Name | 2-chloro-N-cyclohexyl-5-[[2-(2,5-dichloroanilino)acetyl]amino]benzamide |
|---|---|
| PubChem CID | 54819816 |
| Molecular Formula | C21H22Cl3N3O2 |
| Molecular Weight | 454.79 g/mol |
| Exact Mass | 453.08 |
| IUPAC Name | 2-chloro-N-cyclohexyl-5-[[2-(2,5-dichloroanilino)acetyl]amino]benzamide |
| SMILES | O=C(CNc1cc(Cl)ccc1Cl)Nc1ccc(Cl)c(C(=O)NC2CCCCC2)c1 |
| InChI | InChI=1S/C21H22Cl3N3O2/c22-13-6-8-18(24)19(10-13)25-12-20(28)26-15-7-9-17(23)16(11-15)21(29)27-14-4-2-1-3-5-14/h6-11,14,25H,1-5,12H2,(H,26,28)(H,27,29) |
| InChIKey | LXJZXLMDWADHTC-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.79 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |