C26H32ClN3O4 — CID 54833273
2-chloro-N-cyclohexyl-5-[[2-oxo-2-[4-(oxolan-2-ylmethoxy)anilino]ethyl]amino]benzamide (PubChem CID 54833273) has the molecular formula C26H32ClN3O4 and a molecular weight of 486.01 g/mol. Its IUPAC name is 2-chloro-N-cyclohexyl-5-[[2-oxo-2-[4-(oxolan-2-ylmethoxy)anilino]ethyl]amino]benzamide.
| Compound Name | 2-chloro-N-cyclohexyl-5-[[2-oxo-2-[4-(oxolan-2-ylmethoxy)anilino]ethyl]amino]benzamide |
|---|---|
| PubChem CID | 54833273 |
| Molecular Formula | C26H32ClN3O4 |
| Molecular Weight | 486.01 g/mol |
| Exact Mass | 485.21 |
| IUPAC Name | 2-chloro-N-cyclohexyl-5-[[2-oxo-2-[4-(oxolan-2-ylmethoxy)anilino]ethyl]amino]benzamide |
| SMILES | O=C(CNc1ccc(Cl)c(C(=O)NC2CCCCC2)c1)Nc1ccc(OCC2CCCO2)cc1 |
| InChI | InChI=1S/C26H32ClN3O4/c27-24-13-10-20(15-23(24)26(32)30-18-5-2-1-3-6-18)28-16-25(31)29-19-8-11-21(12-9-19)34-17-22-7-4-14-33-22/h8-13,15,18,22,28H,1-7,14,16-17H2,(H,29,31)(H,30,32) |
| InChIKey | KWDNGJXXBOHRAY-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.01 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |