C21H24N2O5 — CID 54816958
methyl 4-[[2-oxo-2-[4-(oxolan-2-ylmethoxy)anilino]ethyl]amino]benzoate (PubChem CID 54816958) has the molecular formula C21H24N2O5 and a molecular weight of 384.43 g/mol. Its IUPAC name is methyl 4-[[2-oxo-2-[4-(oxolan-2-ylmethoxy)anilino]ethyl]amino]benzoate.
| Compound Name | methyl 4-[[2-oxo-2-[4-(oxolan-2-ylmethoxy)anilino]ethyl]amino]benzoate |
|---|---|
| PubChem CID | 54816958 |
| Molecular Formula | C21H24N2O5 |
| Molecular Weight | 384.43 g/mol |
| Exact Mass | 384.17 |
| IUPAC Name | methyl 4-[[2-oxo-2-[4-(oxolan-2-ylmethoxy)anilino]ethyl]amino]benzoate |
| SMILES | COC(=O)c1ccc(NCC(=O)Nc2ccc(OCC3CCCO3)cc2)cc1 |
| InChI | InChI=1S/C21H24N2O5/c1-26-21(25)15-4-6-16(7-5-15)22-13-20(24)23-17-8-10-18(11-9-17)28-14-19-3-2-12-27-19/h4-11,19,22H,2-3,12-14H2,1H3,(H,23,24) |
| InChIKey | YEAVFLYGASVBJK-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.43 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |