C23H28N2O5 — CID 54821487
propyl 4-[[2-[4-(oxolan-2-ylmethoxy)anilino]acetyl]amino]benzoate (PubChem CID 54821487) has the molecular formula C23H28N2O5 and a molecular weight of 412.49 g/mol. Its IUPAC name is propyl 4-[[2-[4-(oxolan-2-ylmethoxy)anilino]acetyl]amino]benzoate.
| Compound Name | propyl 4-[[2-[4-(oxolan-2-ylmethoxy)anilino]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 54821487 |
| Molecular Formula | C23H28N2O5 |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.20 |
| IUPAC Name | propyl 4-[[2-[4-(oxolan-2-ylmethoxy)anilino]acetyl]amino]benzoate |
| SMILES | CCCOC(=O)c1ccc(NC(=O)CNc2ccc(OCC3CCCO3)cc2)cc1 |
| InChI | InChI=1S/C23H28N2O5/c1-2-13-29-23(27)17-5-7-19(8-6-17)25-22(26)15-24-18-9-11-20(12-10-18)30-16-21-4-3-14-28-21/h5-12,21,24H,2-4,13-16H2,1H3,(H,25,26) |
| InChIKey | FVRDUUMKUWECSL-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|