C21H26N2O5 — CID 54813023
propyl 4-[[2-[4-(2-methoxyethoxy)anilino]-2-oxoethyl]amino]benzoate (PubChem CID 54813023) has the molecular formula C21H26N2O5 and a molecular weight of 386.45 g/mol. Its IUPAC name is propyl 4-[[2-[4-(2-methoxyethoxy)anilino]-2-oxoethyl]amino]benzoate.
| Compound Name | propyl 4-[[2-[4-(2-methoxyethoxy)anilino]-2-oxoethyl]amino]benzoate |
|---|---|
| PubChem CID | 54813023 |
| Molecular Formula | C21H26N2O5 |
| Molecular Weight | 386.45 g/mol |
| Exact Mass | 386.18 |
| IUPAC Name | propyl 4-[[2-[4-(2-methoxyethoxy)anilino]-2-oxoethyl]amino]benzoate |
| SMILES | CCCOC(=O)c1ccc(NCC(=O)Nc2ccc(OCCOC)cc2)cc1 |
| InChI | InChI=1S/C21H26N2O5/c1-3-12-28-21(25)16-4-6-17(7-5-16)22-15-20(24)23-18-8-10-19(11-9-18)27-14-13-26-2/h4-11,22H,3,12-15H2,1-2H3,(H,23,24) |
| InChIKey | UZFOMKZJKFJEIQ-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.45 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|