C20H24N2O4 — CID 54816861
methyl 4-[[2-(4-butoxyanilino)-2-oxoethyl]amino]benzoate (PubChem CID 54816861) has the molecular formula C20H24N2O4 and a molecular weight of 356.42 g/mol. Its IUPAC name is methyl 4-[[2-(4-butoxyanilino)-2-oxoethyl]amino]benzoate.
| Compound Name | methyl 4-[[2-(4-butoxyanilino)-2-oxoethyl]amino]benzoate |
|---|---|
| PubChem CID | 54816861 |
| Molecular Formula | C20H24N2O4 |
| Molecular Weight | 356.42 g/mol |
| Exact Mass | 356.17 |
| IUPAC Name | methyl 4-[[2-(4-butoxyanilino)-2-oxoethyl]amino]benzoate |
| SMILES | CCCCOc1ccc(NC(=O)CNc2ccc(C(=O)OC)cc2)cc1 |
| InChI | InChI=1S/C20H24N2O4/c1-3-4-13-26-18-11-9-17(10-12-18)22-19(23)14-21-16-7-5-15(6-8-16)20(24)25-2/h5-12,21H,3-4,13-14H2,1-2H3,(H,22,23) |
| InChIKey | MDCZJILKGKDSMY-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.42 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|