C26H36N2O4 — CID 54821326
N-(4-heptoxyphenyl)-2-[4-(oxolan-2-ylmethoxy)anilino]acetamide (PubChem CID 54821326) has the molecular formula C26H36N2O4 and a molecular weight of 440.58 g/mol. Its IUPAC name is N-(4-heptoxyphenyl)-2-[4-(oxolan-2-ylmethoxy)anilino]acetamide.
| Compound Name | N-(4-heptoxyphenyl)-2-[4-(oxolan-2-ylmethoxy)anilino]acetamide |
|---|---|
| PubChem CID | 54821326 |
| Molecular Formula | C26H36N2O4 |
| Molecular Weight | 440.58 g/mol |
| Exact Mass | 440.27 |
| IUPAC Name | N-(4-heptoxyphenyl)-2-[4-(oxolan-2-ylmethoxy)anilino]acetamide |
| SMILES | CCCCCCCOc1ccc(NC(=O)CNc2ccc(OCC3CCCO3)cc2)cc1 |
| InChI | InChI=1S/C26H36N2O4/c1-2-3-4-5-6-17-30-23-15-11-22(12-16-23)28-26(29)19-27-21-9-13-24(14-10-21)32-20-25-8-7-18-31-25/h9-16,25,27H,2-8,17-20H2,1H3,(H,28,29) |
| InChIKey | GPLNWLPSEMSSOU-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.58 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|