C21H22N2O3 — CID 109051927
1-N-(3-acetylphenyl)-3-N-cyclopentylbenzene-1,3-dicarboxamide (PubChem CID 109051927) has the molecular formula C21H22N2O3 and a molecular weight of 350.42 g/mol. Its IUPAC name is 1-N-(3-acetylphenyl)-3-N-cyclopentylbenzene-1,3-dicarboxamide.
| Compound Name | 1-N-(3-acetylphenyl)-3-N-cyclopentylbenzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 109051927 |
| Molecular Formula | C21H22N2O3 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.16 |
| IUPAC Name | 1-N-(3-acetylphenyl)-3-N-cyclopentylbenzene-1,3-dicarboxamide |
| SMILES | CC(=O)c1cccc(NC(=O)c2cccc(C(=O)NC3CCCC3)c2)c1 |
| InChI | InChI=1S/C21H22N2O3/c1-14(24)15-6-5-11-19(13-15)23-21(26)17-8-4-7-16(12-17)20(25)22-18-9-2-3-10-18/h4-8,11-13,18H,2-3,9-10H2,1H3,(H,22,25)(H,23,26) |
| InChIKey | XBDDHACJWGHMAI-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |