C20H21N3O3 — CID 109080814
2-N-(3-acetylphenyl)-4-N-cyclopentylpyridine-2,4-dicarboxamide (PubChem CID 109080814) has the molecular formula C20H21N3O3 and a molecular weight of 351.41 g/mol. Its IUPAC name is 2-N-(3-acetylphenyl)-4-N-cyclopentylpyridine-2,4-dicarboxamide.
| Compound Name | 2-N-(3-acetylphenyl)-4-N-cyclopentylpyridine-2,4-dicarboxamide |
|---|---|
| PubChem CID | 109080814 |
| Molecular Formula | C20H21N3O3 |
| Molecular Weight | 351.41 g/mol |
| Exact Mass | 351.16 |
| IUPAC Name | 2-N-(3-acetylphenyl)-4-N-cyclopentylpyridine-2,4-dicarboxamide |
| SMILES | CC(=O)c1cccc(NC(=O)c2cc(C(=O)NC3CCCC3)ccn2)c1 |
| InChI | InChI=1S/C20H21N3O3/c1-13(24)14-5-4-8-17(11-14)23-20(26)18-12-15(9-10-21-18)19(25)22-16-6-2-3-7-16/h4-5,8-12,16H,2-3,6-7H2,1H3,(H,22,25)(H,23,26) |
| InChIKey | OUAVFBKSZPZNBD-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.41 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |