C22H27N3O2 — CID 109080782
4-N-cyclopentyl-2-N-(2,6-diethylphenyl)pyridine-2,4-dicarboxamide (PubChem CID 109080782) has the molecular formula C22H27N3O2 and a molecular weight of 365.48 g/mol. Its IUPAC name is 4-N-cyclopentyl-2-N-(2,6-diethylphenyl)pyridine-2,4-dicarboxamide.
| Compound Name | 4-N-cyclopentyl-2-N-(2,6-diethylphenyl)pyridine-2,4-dicarboxamide |
|---|---|
| PubChem CID | 109080782 |
| Molecular Formula | C22H27N3O2 |
| Molecular Weight | 365.48 g/mol |
| Exact Mass | 365.21 |
| IUPAC Name | 4-N-cyclopentyl-2-N-(2,6-diethylphenyl)pyridine-2,4-dicarboxamide |
| SMILES | CCc1cccc(CC)c1NC(=O)c1cc(C(=O)NC2CCCC2)ccn1 |
| InChI | InChI=1S/C22H27N3O2/c1-3-15-8-7-9-16(4-2)20(15)25-22(27)19-14-17(12-13-23-19)21(26)24-18-10-5-6-11-18/h7-9,12-14,18H,3-6,10-11H2,1-2H3,(H,24,26)(H,25,27) |
| InChIKey | MESZBHKYNIGKHE-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.48 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |