C21H25N3O2 — CID 109081429
4-N-cyclohexyl-2-N-(3,5-dimethylphenyl)pyridine-2,4-dicarboxamide (PubChem CID 109081429) has the molecular formula C21H25N3O2 and a molecular weight of 351.45 g/mol. Its IUPAC name is 4-N-cyclohexyl-2-N-(3,5-dimethylphenyl)pyridine-2,4-dicarboxamide.
| Compound Name | 4-N-cyclohexyl-2-N-(3,5-dimethylphenyl)pyridine-2,4-dicarboxamide |
|---|---|
| PubChem CID | 109081429 |
| Molecular Formula | C21H25N3O2 |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.19 |
| IUPAC Name | 4-N-cyclohexyl-2-N-(3,5-dimethylphenyl)pyridine-2,4-dicarboxamide |
| SMILES | Cc1cc(C)cc(NC(=O)c2cc(C(=O)NC3CCCCC3)ccn2)c1 |
| InChI | InChI=1S/C21H25N3O2/c1-14-10-15(2)12-18(11-14)24-21(26)19-13-16(8-9-22-19)20(25)23-17-6-4-3-5-7-17/h8-13,17H,3-7H2,1-2H3,(H,23,25)(H,24,26) |
| InChIKey | WXWGYVIDGAPVQZ-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |