C22H27N3O2 — CID 109107035
5-N-cycloheptyl-3-N-(3,5-dimethylphenyl)pyridine-3,5-dicarboxamide (PubChem CID 109107035) has the molecular formula C22H27N3O2 and a molecular weight of 365.48 g/mol. Its IUPAC name is 5-N-cycloheptyl-3-N-(3,5-dimethylphenyl)pyridine-3,5-dicarboxamide.
| Compound Name | 5-N-cycloheptyl-3-N-(3,5-dimethylphenyl)pyridine-3,5-dicarboxamide |
|---|---|
| PubChem CID | 109107035 |
| Molecular Formula | C22H27N3O2 |
| Molecular Weight | 365.48 g/mol |
| Exact Mass | 365.21 |
| IUPAC Name | 5-N-cycloheptyl-3-N-(3,5-dimethylphenyl)pyridine-3,5-dicarboxamide |
| SMILES | Cc1cc(C)cc(NC(=O)c2cncc(C(=O)NC3CCCCCC3)c2)c1 |
| InChI | InChI=1S/C22H27N3O2/c1-15-9-16(2)11-20(10-15)25-22(27)18-12-17(13-23-14-18)21(26)24-19-7-5-3-4-6-8-19/h9-14,19H,3-8H2,1-2H3,(H,24,26)(H,25,27) |
| InChIKey | KUCULEJMDKBXGH-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.48 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |