C15H19N3O2 — CID 109101527
3-N-cyclopentyl-5-N-cyclopropylpyridine-3,5-dicarboxamide (PubChem CID 109101527) has the molecular formula C15H19N3O2 and a molecular weight of 273.34 g/mol. Its IUPAC name is 3-N-cyclopentyl-5-N-cyclopropylpyridine-3,5-dicarboxamide.
| Compound Name | 3-N-cyclopentyl-5-N-cyclopropylpyridine-3,5-dicarboxamide |
|---|---|
| PubChem CID | 109101527 |
| Molecular Formula | C15H19N3O2 |
| Molecular Weight | 273.34 g/mol |
| Exact Mass | 273.15 |
| IUPAC Name | 3-N-cyclopentyl-5-N-cyclopropylpyridine-3,5-dicarboxamide |
| SMILES | O=C(NC1CCCC1)c1cncc(C(=O)NC2CC2)c1 |
| InChI | InChI=1S/C15H19N3O2/c19-14(17-12-3-1-2-4-12)10-7-11(9-16-8-10)15(20)18-13-5-6-13/h7-9,12-13H,1-6H2,(H,17,19)(H,18,20) |
| InChIKey | QQWPFJCIMWSKAU-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.34 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |