C19H21N3O2 — CID 109103063
5-N-cyclohexyl-3-N-phenylpyridine-3,5-dicarboxamide (PubChem CID 109103063) has the molecular formula C19H21N3O2 and a molecular weight of 323.40 g/mol. Its IUPAC name is 5-N-cyclohexyl-3-N-phenylpyridine-3,5-dicarboxamide.
| Compound Name | 5-N-cyclohexyl-3-N-phenylpyridine-3,5-dicarboxamide |
|---|---|
| PubChem CID | 109103063 |
| Molecular Formula | C19H21N3O2 |
| Molecular Weight | 323.40 g/mol |
| Exact Mass | 323.16 |
| IUPAC Name | 5-N-cyclohexyl-3-N-phenylpyridine-3,5-dicarboxamide |
| SMILES | O=C(Nc1ccccc1)c1cncc(C(=O)NC2CCCCC2)c1 |
| InChI | InChI=1S/C19H21N3O2/c23-18(21-16-7-3-1-4-8-16)14-11-15(13-20-12-14)19(24)22-17-9-5-2-6-10-17/h1,3-4,7-8,11-13,17H,2,5-6,9-10H2,(H,21,23)(H,22,24) |
| InChIKey | XWKNLNWETXEKSU-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.40 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |