C18H18ClN3O2 — CID 109102765
3-N-(3-chlorophenyl)-5-N-cyclopentylpyridine-3,5-dicarboxamide (PubChem CID 109102765) has the molecular formula C18H18ClN3O2 and a molecular weight of 343.81 g/mol. Its IUPAC name is 3-N-(3-chlorophenyl)-5-N-cyclopentylpyridine-3,5-dicarboxamide.
| Compound Name | 3-N-(3-chlorophenyl)-5-N-cyclopentylpyridine-3,5-dicarboxamide |
|---|---|
| PubChem CID | 109102765 |
| Molecular Formula | C18H18ClN3O2 |
| Molecular Weight | 343.81 g/mol |
| Exact Mass | 343.11 |
| IUPAC Name | 3-N-(3-chlorophenyl)-5-N-cyclopentylpyridine-3,5-dicarboxamide |
| SMILES | O=C(Nc1cccc(Cl)c1)c1cncc(C(=O)NC2CCCC2)c1 |
| InChI | InChI=1S/C18H18ClN3O2/c19-14-4-3-7-16(9-14)22-18(24)13-8-12(10-20-11-13)17(23)21-15-5-1-2-6-15/h3-4,7-11,15H,1-2,5-6H2,(H,21,23)(H,22,24) |
| InChIKey | MPFZOQGACNOIHX-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.81 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |