C18H18ClN3O2 — CID 109095035
2-N-(3-chlorophenyl)-6-N-cyclopentylpyridine-2,6-dicarboxamide (PubChem CID 109095035) has the molecular formula C18H18ClN3O2 and a molecular weight of 343.81 g/mol. Its IUPAC name is 2-N-(3-chlorophenyl)-6-N-cyclopentylpyridine-2,6-dicarboxamide.
| Compound Name | 2-N-(3-chlorophenyl)-6-N-cyclopentylpyridine-2,6-dicarboxamide |
|---|---|
| PubChem CID | 109095035 |
| Molecular Formula | C18H18ClN3O2 |
| Molecular Weight | 343.81 g/mol |
| Exact Mass | 343.11 |
| IUPAC Name | 2-N-(3-chlorophenyl)-6-N-cyclopentylpyridine-2,6-dicarboxamide |
| SMILES | O=C(Nc1cccc(Cl)c1)c1cccc(C(=O)NC2CCCC2)n1 |
| InChI | InChI=1S/C18H18ClN3O2/c19-12-5-3-8-14(11-12)21-18(24)16-10-4-9-15(22-16)17(23)20-13-6-1-2-7-13/h3-5,8-11,13H,1-2,6-7H2,(H,20,23)(H,21,24) |
| InChIKey | ACZUBHAOJLACCP-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.81 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |