C16H17ClN4O — CID 109297953
N-(3-chlorophenyl)-2-(cyclopentylamino)pyrimidine-4-carboxamide (PubChem CID 109297953) has the molecular formula C16H17ClN4O and a molecular weight of 316.79 g/mol. Its IUPAC name is N-(3-chlorophenyl)-2-(cyclopentylamino)pyrimidine-4-carboxamide.
| Compound Name | N-(3-chlorophenyl)-2-(cyclopentylamino)pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 109297953 |
| Molecular Formula | C16H17ClN4O |
| Molecular Weight | 316.79 g/mol |
| Exact Mass | 316.11 |
| IUPAC Name | N-(3-chlorophenyl)-2-(cyclopentylamino)pyrimidine-4-carboxamide |
| SMILES | O=C(Nc1cccc(Cl)c1)c1ccnc(NC2CCCC2)n1 |
| InChI | InChI=1S/C16H17ClN4O/c17-11-4-3-7-13(10-11)19-15(22)14-8-9-18-16(21-14)20-12-5-1-2-6-12/h3-4,7-10,12H,1-2,5-6H2,(H,19,22)(H,18,20,21) |
| InChIKey | KFASLHBDYWMFFF-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.79 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |