C16H16Cl2N4O — CID 109298018
2-(cyclopentylamino)-N-(3,5-dichlorophenyl)pyrimidine-4-carboxamide (PubChem CID 109298018) has the molecular formula C16H16Cl2N4O and a molecular weight of 351.24 g/mol. Its IUPAC name is 2-(cyclopentylamino)-N-(3,5-dichlorophenyl)pyrimidine-4-carboxamide.
| Compound Name | 2-(cyclopentylamino)-N-(3,5-dichlorophenyl)pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 109298018 |
| Molecular Formula | C16H16Cl2N4O |
| Molecular Weight | 351.24 g/mol |
| Exact Mass | 350.07 |
| IUPAC Name | 2-(cyclopentylamino)-N-(3,5-dichlorophenyl)pyrimidine-4-carboxamide |
| SMILES | O=C(Nc1cc(Cl)cc(Cl)c1)c1ccnc(NC2CCCC2)n1 |
| InChI | InChI=1S/C16H16Cl2N4O/c17-10-7-11(18)9-13(8-10)20-15(23)14-5-6-19-16(22-14)21-12-3-1-2-4-12/h5-9,12H,1-4H2,(H,20,23)(H,19,21,22) |
| InChIKey | UWCVNNIIHHWJEM-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.24 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |