C23H29N3O2 — CID 109103083
5-N-cyclohexyl-3-N-(2,6-diethylphenyl)pyridine-3,5-dicarboxamide (PubChem CID 109103083) has the molecular formula C23H29N3O2 and a molecular weight of 379.50 g/mol. Its IUPAC name is 5-N-cyclohexyl-3-N-(2,6-diethylphenyl)pyridine-3,5-dicarboxamide.
| Compound Name | 5-N-cyclohexyl-3-N-(2,6-diethylphenyl)pyridine-3,5-dicarboxamide |
|---|---|
| PubChem CID | 109103083 |
| Molecular Formula | C23H29N3O2 |
| Molecular Weight | 379.50 g/mol |
| Exact Mass | 379.23 |
| IUPAC Name | 5-N-cyclohexyl-3-N-(2,6-diethylphenyl)pyridine-3,5-dicarboxamide |
| SMILES | CCc1cccc(CC)c1NC(=O)c1cncc(C(=O)NC2CCCCC2)c1 |
| InChI | InChI=1S/C23H29N3O2/c1-3-16-9-8-10-17(4-2)21(16)26-23(28)19-13-18(14-24-15-19)22(27)25-20-11-6-5-7-12-20/h8-10,13-15,20H,3-7,11-12H2,1-2H3,(H,25,27)(H,26,28) |
| InChIKey | HJQPFOJIKFJIAT-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.50 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |