C22H27N3O2 — CID 109107040
3-N-cycloheptyl-5-N-ethyl-5-N-phenylpyridine-3,5-dicarboxamide (PubChem CID 109107040) has the molecular formula C22H27N3O2 and a molecular weight of 365.48 g/mol. Its IUPAC name is 3-N-cycloheptyl-5-N-ethyl-5-N-phenylpyridine-3,5-dicarboxamide.
| Compound Name | 3-N-cycloheptyl-5-N-ethyl-5-N-phenylpyridine-3,5-dicarboxamide |
|---|---|
| PubChem CID | 109107040 |
| Molecular Formula | C22H27N3O2 |
| Molecular Weight | 365.48 g/mol |
| Exact Mass | 365.21 |
| IUPAC Name | 3-N-cycloheptyl-5-N-ethyl-5-N-phenylpyridine-3,5-dicarboxamide |
| SMILES | CCN(C(=O)c1cncc(C(=O)NC2CCCCCC2)c1)c1ccccc1 |
| InChI | InChI=1S/C22H27N3O2/c1-2-25(20-12-8-5-9-13-20)22(27)18-14-17(15-23-16-18)21(26)24-19-10-6-3-4-7-11-19/h5,8-9,12-16,19H,2-4,6-7,10-11H2,1H3,(H,24,26) |
| InChIKey | OYOFZGPXDYBWFA-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.48 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |