C19H21N3O4S — CID 109106512
3-N-(1,1-dioxothiolan-3-yl)-5-N-ethyl-5-N-phenylpyridine-3,5-dicarboxamide (PubChem CID 109106512) has the molecular formula C19H21N3O4S and a molecular weight of 387.46 g/mol. Its IUPAC name is 3-N-(1,1-dioxothiolan-3-yl)-5-N-ethyl-5-N-phenylpyridine-3,5-dicarboxamide.
| Compound Name | 3-N-(1,1-dioxothiolan-3-yl)-5-N-ethyl-5-N-phenylpyridine-3,5-dicarboxamide |
|---|---|
| PubChem CID | 109106512 |
| Molecular Formula | C19H21N3O4S |
| Molecular Weight | 387.46 g/mol |
| Exact Mass | 387.13 |
| IUPAC Name | 3-N-(1,1-dioxothiolan-3-yl)-5-N-ethyl-5-N-phenylpyridine-3,5-dicarboxamide |
| SMILES | CCN(C(=O)c1cncc(C(=O)NC2CCS(=O)(=O)C2)c1)c1ccccc1 |
| InChI | InChI=1S/C19H21N3O4S/c1-2-22(17-6-4-3-5-7-17)19(24)15-10-14(11-20-12-15)18(23)21-16-8-9-27(25,26)13-16/h3-7,10-12,16H,2,8-9,13H2,1H3,(H,21,23) |
| InChIKey | VTLWGTAGLFJPOQ-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 96.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.46 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |