C18H21N3O3S — CID 109237184
N-(1,1-dioxothiolan-3-yl)-5-(2-ethylanilino)pyridine-3-carboxamide (PubChem CID 109237184) has the molecular formula C18H21N3O3S and a molecular weight of 359.45 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-5-(2-ethylanilino)pyridine-3-carboxamide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-5-(2-ethylanilino)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 109237184 |
| Molecular Formula | C18H21N3O3S |
| Molecular Weight | 359.45 g/mol |
| Exact Mass | 359.13 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-5-(2-ethylanilino)pyridine-3-carboxamide |
| SMILES | CCc1ccccc1Nc1cncc(C(=O)NC2CCS(=O)(=O)C2)c1 |
| InChI | InChI=1S/C18H21N3O3S/c1-2-13-5-3-4-6-17(13)20-16-9-14(10-19-11-16)18(22)21-15-7-8-25(23,24)12-15/h3-6,9-11,15,20H,2,7-8,12H2,1H3,(H,21,22) |
| InChIKey | DFAJSZJICTZVSY-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.45 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |