C17H19N3O3S — CID 109237173
N-(1,1-dioxothiolan-3-yl)-5-(3-methylanilino)pyridine-3-carboxamide (PubChem CID 109237173) has the molecular formula C17H19N3O3S and a molecular weight of 345.42 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-5-(3-methylanilino)pyridine-3-carboxamide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-5-(3-methylanilino)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 109237173 |
| Molecular Formula | C17H19N3O3S |
| Molecular Weight | 345.42 g/mol |
| Exact Mass | 345.11 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-5-(3-methylanilino)pyridine-3-carboxamide |
| SMILES | Cc1cccc(Nc2cncc(C(=O)NC3CCS(=O)(=O)C3)c2)c1 |
| InChI | InChI=1S/C17H19N3O3S/c1-12-3-2-4-14(7-12)19-16-8-13(9-18-10-16)17(21)20-15-5-6-24(22,23)11-15/h2-4,7-10,15,19H,5-6,11H2,1H3,(H,20,21) |
| InChIKey | XZNDVTZJQMASOL-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.42 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |